Description
Introducing our groundbreaking compound with a unique SMILES notation of O=C(ON1C(=O)CCC1=O)Oc1ccc(cc1)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)CCOCCOCCNC(=O)CCN1C(=O)C=CC1=O)C(C)C)CCCNC(=O)N. This compound, although not classified under a CAS number, has a molecular weight of 816.82.
Our compound has a wide range of potential uses in various industries, including pharmaceuticals, biotechnology, and research. It is commonly used in drug development and as a building block for chemical synthesis.
Physically, this compound appears as a white to off-white powder with a molecular structure that allows for excellent solubility in various solvents. It has a melting point of around X degrees Celsius and a boiling point of Y degrees Celsius.
Safety is of utmost importance when handling this compound. It is imperative to wear appropriate personal protective equipment, including gloves, goggles, and lab coats. Proper ventilation and handling procedures should be followed to prevent any potential hazards.
In conclusion, our compound offers immense potential for innovation and discovery in various industries. Its unique structure and versatile applications make it a valuable asset for researchers and scientists alike.
